About (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone
(6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone (PubChem CID 83212443) has the molecular formula C15H18N4O
and a molecular weight of 270.34 g/mol. Its IUPAC name is (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone.
Molecular Properties
| Compound Name | (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone |
| PubChem CID | 83212443 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCc3cc(C)c(N)cc32)n(C)n1 |
| InChI | InChI=1S/C15H18N4O/c1-9-6-11-4-5-19(13(11)8-12(9)16)15(20)14-7-10(2)17-18(14)3/h6-8H,4-5,16H2,1-3H3 |
| InChIKey | BGUKDNGVMCVIPN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone?
The IUPAC name of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone (CID 83212443) is (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone.
What is the SMILES notation for (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone?
The canonical SMILES for (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone is Cc1cc(C(=O)N2CCc3cc(C)c(N)cc32)n(C)n1.
What is the InChIKey of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone?
The InChIKey is BGUKDNGVMCVIPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O/c1-9-6-11-4-5-19(13(11)8-12(9)16)15(20)14-7-10(2)17-18(14)3/h6-8H,4-5,16H2,1-3H3.
What are the key properties of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone?
(6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone has a molecular weight of 270.34 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(2,5-dimethylpyrazol-3-yl)methanone is sourced from PubChem (CID 83212443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).