C16H20N4O — CID 83210635
(6-amino-5-methyl-2,3-dihydroindol-1-yl)-(3-ethyl-1-methylpyrazol-5-yl)methanone (PubChem CID 83210635) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(3-ethyl-1-methylpyrazol-5-yl)methanone.
| Compound Name | (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(3-ethyl-1-methylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 83210635 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(3-ethyl-1-methylpyrazol-5-yl)methanone |
| SMILES | CCc1cc(C(=O)N2CCc3cc(C)c(N)cc32)n(C)n1 |
| InChI | InChI=1S/C16H20N4O/c1-4-12-8-15(19(3)18-12)16(21)20-6-5-11-7-10(2)13(17)9-14(11)20/h7-9H,4-6,17H2,1-3H3 |
| InChIKey | IAYGMBNCTLKHGO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|