C14H22N2O — CID 83213384
2-(oxan-4-ylmethyl)-4,5,6,7-tetrahydroisoindol-4-amine (PubChem CID 83213384) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-(oxan-4-ylmethyl)-4,5,6,7-tetrahydroisoindol-4-amine.
| Compound Name | 2-(oxan-4-ylmethyl)-4,5,6,7-tetrahydroisoindol-4-amine |
|---|---|
| PubChem CID | 83213384 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-(oxan-4-ylmethyl)-4,5,6,7-tetrahydroisoindol-4-amine |
| SMILES | NC1CCCc2cn(CC3CCOCC3)cc21 |
| InChI | InChI=1S/C14H22N2O/c15-14-3-1-2-12-9-16(10-13(12)14)8-11-4-6-17-7-5-11/h9-11,14H,1-8,15H2 |
| InChIKey | DHJWKIGILPSCHA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |