C12H15NO4 — CID 83213949
5-(pyridin-2-ylmethoxymethyl)oxolane-2-carboxylic acid (PubChem CID 83213949) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 5-(pyridin-2-ylmethoxymethyl)oxolane-2-carboxylic acid.
| Compound Name | 5-(pyridin-2-ylmethoxymethyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 83213949 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 5-(pyridin-2-ylmethoxymethyl)oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(COCc2ccccn2)O1 |
| InChI | InChI=1S/C12H15NO4/c14-12(15)11-5-4-10(17-11)8-16-7-9-3-1-2-6-13-9/h1-3,6,10-11H,4-5,7-8H2,(H,14,15) |
| InChIKey | SYYCQXUQCHQHPR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |