propan-2-yl 2-(pyridin-3-ylmethoxy)acetate

C11H15NO3 — CID 83214187

IUPACpropan-2-yl 2-(pyridin-3-ylmethoxy)acetate
SMILESCC(C)OC(=O)COCc1cccnc1
InChIInChI=1S/C11H15NO3/c1-9(2)15-11(13)8-14-7-10-4-3-5-12-6-10/h3-6,9H,7-8H2,1-2H3
InChIKeyBUOXLSJYNPCSRZ-UHFFFAOYSA-N
MW209.25 g/mol
LogP1.55
Rot. Bonds5

About propan-2-yl 2-(pyridin-3-ylmethoxy)acetate

propan-2-yl 2-(pyridin-3-ylmethoxy)acetate (PubChem CID 83214187) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is propan-2-yl 2-(pyridin-3-ylmethoxy)acetate.

Molecular Properties

Compound Namepropan-2-yl 2-(pyridin-3-ylmethoxy)acetate
PubChem CID83214187
Molecular FormulaC11H15NO3
Molecular Weight209.25 g/mol
Exact Mass209.11
IUPAC Namepropan-2-yl 2-(pyridin-3-ylmethoxy)acetate
SMILESCC(C)OC(=O)COCc1cccnc1
InChIInChI=1S/C11H15NO3/c1-9(2)15-11(13)8-14-7-10-4-3-5-12-6-10/h3-6,9H,7-8H2,1-2H3
InChIKeyBUOXLSJYNPCSRZ-UHFFFAOYSA-N
XLogP1.55
TPSA48.42 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.25
LogP ≤ 51.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze propan-2-yl 2-(pyridin-3-ylmethoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2-(pyridin-3-ylmethoxy)acetate?
The IUPAC name of propan-2-yl 2-(pyridin-3-ylmethoxy)acetate (CID 83214187) is propan-2-yl 2-(pyridin-3-ylmethoxy)acetate.
What is the SMILES notation for propan-2-yl 2-(pyridin-3-ylmethoxy)acetate?
The canonical SMILES for propan-2-yl 2-(pyridin-3-ylmethoxy)acetate is CC(C)OC(=O)COCc1cccnc1.
What is the InChIKey of propan-2-yl 2-(pyridin-3-ylmethoxy)acetate?
The InChIKey is BUOXLSJYNPCSRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-9(2)15-11(13)8-14-7-10-4-3-5-12-6-10/h3-6,9H,7-8H2,1-2H3.
What are the key properties of propan-2-yl 2-(pyridin-3-ylmethoxy)acetate?
propan-2-yl 2-(pyridin-3-ylmethoxy)acetate has a molecular weight of 209.25 g/mol, XLogP of 1.55, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(pyridin-3-ylmethoxy)acetate is sourced from PubChem (CID 83214187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).