C14H15FN2O2S — CID 83215271
2-amino-3-fluoro-6-(1-thiophen-3-ylpropan-2-ylamino)benzoic acid (PubChem CID 83215271) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-amino-3-fluoro-6-(1-thiophen-3-ylpropan-2-ylamino)benzoic acid.
| Compound Name | 2-amino-3-fluoro-6-(1-thiophen-3-ylpropan-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 83215271 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-amino-3-fluoro-6-(1-thiophen-3-ylpropan-2-ylamino)benzoic acid |
| SMILES | CC(Cc1ccsc1)Nc1ccc(F)c(N)c1C(=O)O |
| InChI | InChI=1S/C14H15FN2O2S/c1-8(6-9-4-5-20-7-9)17-11-3-2-10(15)13(16)12(11)14(18)19/h2-5,7-8,17H,6,16H2,1H3,(H,18,19) |
| InChIKey | DMYDFLNSBBZKAU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|