C14H15F3N2S — CID 61474884
1-N-(1-thiophen-3-ylpropan-2-yl)-4-(trifluoromethyl)benzene-1,2-diamine (PubChem CID 61474884) has the molecular formula C14H15F3N2S and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-N-(1-thiophen-3-ylpropan-2-yl)-4-(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | 1-N-(1-thiophen-3-ylpropan-2-yl)-4-(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 61474884 |
| Molecular Formula | C14H15F3N2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-N-(1-thiophen-3-ylpropan-2-yl)-4-(trifluoromethyl)benzene-1,2-diamine |
| SMILES | CC(Cc1ccsc1)Nc1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C14H15F3N2S/c1-9(6-10-4-5-20-8-10)19-13-3-2-11(7-12(13)18)14(15,16)17/h2-5,7-9,19H,6,18H2,1H3 |
| InChIKey | SBHCAKBIXOMIGZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|