C14H17N3OS — CID 61475795
2-amino-5-(1-thiophen-3-ylpropan-2-ylamino)benzamide (PubChem CID 61475795) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 2-amino-5-(1-thiophen-3-ylpropan-2-ylamino)benzamide.
| Compound Name | 2-amino-5-(1-thiophen-3-ylpropan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 61475795 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-amino-5-(1-thiophen-3-ylpropan-2-ylamino)benzamide |
| SMILES | CC(Cc1ccsc1)Nc1ccc(N)c(C(N)=O)c1 |
| InChI | InChI=1S/C14H17N3OS/c1-9(6-10-4-5-19-8-10)17-11-2-3-13(15)12(7-11)14(16)18/h2-5,7-9,17H,6,15H2,1H3,(H2,16,18) |
| InChIKey | RHMIACVXNSHPAH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|