C12H16N2O4S — CID 83229494
4-(cyclopentyloxysulfamoyl)benzamide (PubChem CID 83229494) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-(cyclopentyloxysulfamoyl)benzamide.
| Compound Name | 4-(cyclopentyloxysulfamoyl)benzamide |
|---|---|
| PubChem CID | 83229494 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(cyclopentyloxysulfamoyl)benzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)NOC2CCCC2)cc1 |
| InChI | InChI=1S/C12H16N2O4S/c13-12(15)9-5-7-11(8-6-9)19(16,17)14-18-10-3-1-2-4-10/h5-8,10,14H,1-4H2,(H2,13,15) |
| InChIKey | GVHLTSLXIAQAOU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|