C19H29N3O4S — CID 18513134
4-[(1-amino-2-cyclohexyl-3,3-dimethyl-1-oxobutan-2-yl)sulfamoyl]benzamide (PubChem CID 18513134) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-[(1-amino-2-cyclohexyl-3,3-dimethyl-1-oxobutan-2-yl)sulfamoyl]benzamide.
| Compound Name | 4-[(1-amino-2-cyclohexyl-3,3-dimethyl-1-oxobutan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 18513134 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 4-[(1-amino-2-cyclohexyl-3,3-dimethyl-1-oxobutan-2-yl)sulfamoyl]benzamide |
| SMILES | CC(C)(C)C(NS(=O)(=O)c1ccc(C(N)=O)cc1)(C(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C19H29N3O4S/c1-18(2,3)19(17(21)24,14-7-5-4-6-8-14)22-27(25,26)15-11-9-13(10-12-15)16(20)23/h9-12,14,22H,4-8H2,1-3H3,(H2,20,23)(H2,21,24) |
| InChIKey | PXFVMQALIZDPKI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |