C23H29N3O4S — CID 18513135
4-[(1-amino-2-cyclohexyl-1-oxo-4-phenylbutan-2-yl)sulfamoyl]benzamide (PubChem CID 18513135) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-[(1-amino-2-cyclohexyl-1-oxo-4-phenylbutan-2-yl)sulfamoyl]benzamide.
| Compound Name | 4-[(1-amino-2-cyclohexyl-1-oxo-4-phenylbutan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 18513135 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[(1-amino-2-cyclohexyl-1-oxo-4-phenylbutan-2-yl)sulfamoyl]benzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)NC(CCc2ccccc2)(C(N)=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H29N3O4S/c24-21(27)18-11-13-20(14-12-18)31(29,30)26-23(22(25)28,19-9-5-2-6-10-19)16-15-17-7-3-1-4-8-17/h1,3-4,7-8,11-14,19,26H,2,5-6,9-10,15-16H2,(H2,24,27)(H2,25,28) |
| InChIKey | RIOPLRFWYSDLFX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |