C14H20N2O3S2 — CID 83237132
3-(1,1-dioxothiolan-3-yl)-5-propyl-2-thiophen-2-ylimidazolidin-4-one (PubChem CID 83237132) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-propyl-2-thiophen-2-ylimidazolidin-4-one.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-propyl-2-thiophen-2-ylimidazolidin-4-one |
|---|---|
| PubChem CID | 83237132 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-propyl-2-thiophen-2-ylimidazolidin-4-one |
| SMILES | CCCC1NC(c2cccs2)N(C2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C14H20N2O3S2/c1-2-4-11-14(17)16(10-6-8-21(18,19)9-10)13(15-11)12-5-3-7-20-12/h3,5,7,10-11,13,15H,2,4,6,8-9H2,1H3 |
| InChIKey | BNVCBNTVIDVTST-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |