C12H20N2O — CID 83239179
3-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]imidazolidin-4-one (PubChem CID 83239179) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]imidazolidin-4-one.
| Compound Name | 3-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]imidazolidin-4-one |
|---|---|
| PubChem CID | 83239179 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 3-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]imidazolidin-4-one |
| SMILES | CC(C1CC2CCC1C2)N1CNCC1=O |
| InChI | InChI=1S/C12H20N2O/c1-8(14-7-13-6-12(14)15)11-5-9-2-3-10(11)4-9/h8-11,13H,2-7H2,1H3 |
| InChIKey | LJINZDWWVZEQIT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |