C12H9ClN4O — CID 83240225
4-chloro-6-(5-methyl-1-benzofuran-2-yl)-1,3,5-triazin-2-amine (PubChem CID 83240225) has the molecular formula C12H9ClN4O and a molecular weight of 260.68 g/mol. Its IUPAC name is 4-chloro-6-(5-methyl-1-benzofuran-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(5-methyl-1-benzofuran-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 83240225 |
| Molecular Formula | C12H9ClN4O |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-chloro-6-(5-methyl-1-benzofuran-2-yl)-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc2oc(-c3nc(N)nc(Cl)n3)cc2c1 |
| InChI | InChI=1S/C12H9ClN4O/c1-6-2-3-8-7(4-6)5-9(18-8)10-15-11(13)17-12(14)16-10/h2-5H,1H3,(H2,14,15,16,17) |
| InChIKey | VGMCONDNNZQWKQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |