C14H20N2O3S2 — CID 83246059
2-(4-methylsulfanylphenyl)-3-(3-methylsulfonylpropyl)imidazolidin-4-one (PubChem CID 83246059) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-(4-methylsulfanylphenyl)-3-(3-methylsulfonylpropyl)imidazolidin-4-one.
| Compound Name | 2-(4-methylsulfanylphenyl)-3-(3-methylsulfonylpropyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83246059 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(4-methylsulfanylphenyl)-3-(3-methylsulfonylpropyl)imidazolidin-4-one |
| SMILES | CSc1ccc(C2NCC(=O)N2CCCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-20-12-6-4-11(5-7-12)14-15-10-13(17)16(14)8-3-9-21(2,18)19/h4-7,14-15H,3,8-10H2,1-2H3 |
| InChIKey | FQHXEKQADNNLQT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |