C10H11F3N2OS — CID 83254696
2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one (PubChem CID 83254696) has the molecular formula C10H11F3N2OS and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one.
| Compound Name | 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83254696 |
| Molecular Formula | C10H11F3N2OS |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one |
| SMILES | O=C1CNC(c2ccsc2)N1CCC(F)(F)F |
| InChI | InChI=1S/C10H11F3N2OS/c11-10(12,13)2-3-15-8(16)5-14-9(15)7-1-4-17-6-7/h1,4,6,9,14H,2-3,5H2 |
| InChIKey | ZWRUGJQASPXKFR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |