About 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one
2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one (PubChem CID 83254696) has the molecular formula C10H11F3N2OS
and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one.
Molecular Properties
| Compound Name | 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one |
| PubChem CID | 83254696 |
| Molecular Formula | C10H11F3N2OS |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one |
| SMILES | O=C1CNC(c2ccsc2)N1CCC(F)(F)F |
| InChI | InChI=1S/C10H11F3N2OS/c11-10(12,13)2-3-15-8(16)5-14-9(15)7-1-4-17-6-7/h1,4,6,9,14H,2-3,5H2 |
| InChIKey | ZWRUGJQASPXKFR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one?
The IUPAC name of 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one (CID 83254696) is 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one.
What is the SMILES notation for 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one?
The canonical SMILES for 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one is O=C1CNC(c2ccsc2)N1CCC(F)(F)F.
What is the InChIKey of 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one?
The InChIKey is ZWRUGJQASPXKFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2OS/c11-10(12,13)2-3-15-8(16)5-14-9(15)7-1-4-17-6-7/h1,4,6,9,14H,2-3,5H2.
What are the key properties of 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one?
2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one has a molecular weight of 264.27 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-3-yl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one is sourced from PubChem (CID 83254696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).