C13H17F3N2OS — CID 83259776
5-methyl-2-thiophen-3-yl-3-(5,5,5-trifluoropentyl)imidazolidin-4-one (PubChem CID 83259776) has the molecular formula C13H17F3N2OS and a molecular weight of 306.35 g/mol. Its IUPAC name is 5-methyl-2-thiophen-3-yl-3-(5,5,5-trifluoropentyl)imidazolidin-4-one.
| Compound Name | 5-methyl-2-thiophen-3-yl-3-(5,5,5-trifluoropentyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83259776 |
| Molecular Formula | C13H17F3N2OS |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 5-methyl-2-thiophen-3-yl-3-(5,5,5-trifluoropentyl)imidazolidin-4-one |
| SMILES | CC1NC(c2ccsc2)N(CCCCC(F)(F)F)C1=O |
| InChI | InChI=1S/C13H17F3N2OS/c1-9-12(19)18(6-3-2-5-13(14,15)16)11(17-9)10-4-7-20-8-10/h4,7-9,11,17H,2-3,5-6H2,1H3 |
| InChIKey | MAECLUAFWORGSE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|