C11H22N2OS — CID 83257702
2-methyl-5-(2-methylpropyl)-3-(2-methylsulfanylethyl)imidazolidin-4-one (PubChem CID 83257702) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 2-methyl-5-(2-methylpropyl)-3-(2-methylsulfanylethyl)imidazolidin-4-one.
| Compound Name | 2-methyl-5-(2-methylpropyl)-3-(2-methylsulfanylethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83257702 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-methyl-5-(2-methylpropyl)-3-(2-methylsulfanylethyl)imidazolidin-4-one |
| SMILES | CSCCN1C(=O)C(CC(C)C)NC1C |
| InChI | InChI=1S/C11H22N2OS/c1-8(2)7-10-11(14)13(5-6-15-4)9(3)12-10/h8-10,12H,5-7H2,1-4H3 |
| InChIKey | JDMUWGJMAHBDJY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |