C13H15BrFN — CID 83261455
4-[(2-bromo-4-fluorophenyl)methyl]cyclohex-3-en-1-amine (PubChem CID 83261455) has the molecular formula C13H15BrFN and a molecular weight of 284.17 g/mol. Its IUPAC name is 4-[(2-bromo-4-fluorophenyl)methyl]cyclohex-3-en-1-amine.
| Compound Name | 4-[(2-bromo-4-fluorophenyl)methyl]cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 83261455 |
| Molecular Formula | C13H15BrFN |
| Molecular Weight | 284.17 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 4-[(2-bromo-4-fluorophenyl)methyl]cyclohex-3-en-1-amine |
| SMILES | NC1CC=C(Cc2ccc(F)cc2Br)CC1 |
| InChI | InChI=1S/C13H15BrFN/c14-13-8-11(15)4-3-10(13)7-9-1-5-12(16)6-2-9/h1,3-4,8,12H,2,5-7,16H2 |
| InChIKey | PXDLXDRRRACPQK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|