About 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine
4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine (PubChem CID 83261457) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine.
Molecular Properties
| Compound Name | 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine |
| PubChem CID | 83261457 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine |
| SMILES | Cc1ccc(C2=CCC(N)CC2)cc1C |
| InChI | InChI=1S/C14H19N/c1-10-3-4-13(9-11(10)2)12-5-7-14(15)8-6-12/h3-5,9,14H,6-8,15H2,1-2H3 |
| InChIKey | NBIHWJSZUYDZQD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine?
The IUPAC name of 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine (CID 83261457) is 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine.
What is the SMILES notation for 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine?
The canonical SMILES for 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine is Cc1ccc(C2=CCC(N)CC2)cc1C.
What is the InChIKey of 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine?
The InChIKey is NBIHWJSZUYDZQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-10-3-4-13(9-11(10)2)12-5-7-14(15)8-6-12/h3-5,9,14H,6-8,15H2,1-2H3.
What are the key properties of 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine?
4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine has a molecular weight of 201.31 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylphenyl)cyclohex-3-en-1-amine is sourced from PubChem (CID 83261457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).