C12H15F3N2O2S — CID 83263550
5-methyl-2-thiophen-3-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidin-4-one (PubChem CID 83263550) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 5-methyl-2-thiophen-3-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidin-4-one.
| Compound Name | 5-methyl-2-thiophen-3-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidin-4-one |
|---|---|
| PubChem CID | 83263550 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 5-methyl-2-thiophen-3-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidin-4-one |
| SMILES | CC1NC(c2ccsc2)N(CCOCC(F)(F)F)C1=O |
| InChI | InChI=1S/C12H15F3N2O2S/c1-8-11(18)17(3-4-19-7-12(13,14)15)10(16-8)9-2-5-20-6-9/h2,5-6,8,10,16H,3-4,7H2,1H3 |
| InChIKey | LSBQQYABDCMQBV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|