C12H21N3 — CID 83266034
2-N-(2,3-dimethylbutyl)-5-methylpyridine-2,4-diamine (PubChem CID 83266034) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-N-(2,3-dimethylbutyl)-5-methylpyridine-2,4-diamine.
| Compound Name | 2-N-(2,3-dimethylbutyl)-5-methylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 83266034 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-N-(2,3-dimethylbutyl)-5-methylpyridine-2,4-diamine |
| SMILES | Cc1cnc(NCC(C)C(C)C)cc1N |
| InChI | InChI=1S/C12H21N3/c1-8(2)9(3)6-14-12-5-11(13)10(4)7-15-12/h5,7-9H,6H2,1-4H3,(H3,13,14,15) |
| InChIKey | FULWTAHQSHUZOC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |