C15H17N3O3 — CID 83266871
5-methyl-4-nitro-N-(3-phenoxypropyl)pyridin-2-amine (PubChem CID 83266871) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-methyl-4-nitro-N-(3-phenoxypropyl)pyridin-2-amine.
| Compound Name | 5-methyl-4-nitro-N-(3-phenoxypropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 83266871 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 5-methyl-4-nitro-N-(3-phenoxypropyl)pyridin-2-amine |
| SMILES | Cc1cnc(NCCCOc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O3/c1-12-11-17-15(10-14(12)18(19)20)16-8-5-9-21-13-6-3-2-4-7-13/h2-4,6-7,10-11H,5,8-9H2,1H3,(H,16,17) |
| InChIKey | MVVZGNYAOFTIIO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|