C16H21FN2OS — CID 83266971
2-(2-fluorophenyl)-5-methyl-3-(thian-2-ylmethyl)imidazolidin-4-one (PubChem CID 83266971) has the molecular formula C16H21FN2OS and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-5-methyl-3-(thian-2-ylmethyl)imidazolidin-4-one.
| Compound Name | 2-(2-fluorophenyl)-5-methyl-3-(thian-2-ylmethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83266971 |
| Molecular Formula | C16H21FN2OS |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-(2-fluorophenyl)-5-methyl-3-(thian-2-ylmethyl)imidazolidin-4-one |
| SMILES | CC1NC(c2ccccc2F)N(CC2CCCCS2)C1=O |
| InChI | InChI=1S/C16H21FN2OS/c1-11-16(20)19(10-12-6-4-5-9-21-12)15(18-11)13-7-2-3-8-14(13)17/h2-3,7-8,11-12,15,18H,4-6,9-10H2,1H3 |
| InChIKey | ZHPPNTNUIVJPLH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |