C16H21FN2O — CID 83270186
3-(2,2-dimethylcyclopentyl)-2-(3-fluorophenyl)imidazolidin-4-one (PubChem CID 83270186) has the molecular formula C16H21FN2O and a molecular weight of 276.35 g/mol. Its IUPAC name is 3-(2,2-dimethylcyclopentyl)-2-(3-fluorophenyl)imidazolidin-4-one.
| Compound Name | 3-(2,2-dimethylcyclopentyl)-2-(3-fluorophenyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83270186 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-(2,2-dimethylcyclopentyl)-2-(3-fluorophenyl)imidazolidin-4-one |
| SMILES | CC1(C)CCCC1N1C(=O)CNC1c1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN2O/c1-16(2)8-4-7-13(16)19-14(20)10-18-15(19)11-5-3-6-12(17)9-11/h3,5-6,9,13,15,18H,4,7-8,10H2,1-2H3 |
| InChIKey | FHWNQMBBVCCXNX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |