C13H21N3O2 — CID 83271531
N,3,3-trimethyl-1-(5-methyl-4-nitro-2-pyridinyl)butan-2-amine (PubChem CID 83271531) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is N,3,3-trimethyl-1-(5-methyl-4-nitro-2-pyridinyl)butan-2-amine.
| Compound Name | N,3,3-trimethyl-1-(5-methyl-4-nitro-2-pyridinyl)butan-2-amine |
|---|---|
| PubChem CID | 83271531 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | N,3,3-trimethyl-1-(5-methyl-4-nitro-2-pyridinyl)butan-2-amine |
| SMILES | CNC(Cc1cc([N+](=O)[O-])c(C)cn1)C(C)(C)C |
| InChI | InChI=1S/C13H21N3O2/c1-9-8-15-10(6-11(9)16(17)18)7-12(14-5)13(2,3)4/h6,8,12,14H,7H2,1-5H3 |
| InChIKey | KMIVOQZSDQYUHB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|