C25H25FN4O2 — CID 83276006
(E)-1-[4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 83276006) has the molecular formula C25H25FN4O2 and a molecular weight of 432.50 g/mol. Its IUPAC name is (E)-1-[4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 83276006 |
| Molecular Formula | C25H25FN4O2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (E)-1-[4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1cc(F)ccc1Oc1cc(N2CCN(C(=O)/C=C/c3ccccc3)C(C)C2)ncn1 |
| InChI | InChI=1S/C25H25FN4O2/c1-18-14-21(26)9-10-22(18)32-24-15-23(27-17-28-24)29-12-13-30(19(2)16-29)25(31)11-8-20-6-4-3-5-7-20/h3-11,14-15,17,19H,12-13,16H2,1-2H3/b11-8+ |
| InChIKey | OJRWHYVEGODZTF-DHZHZOJOSA-N |
| XLogP | 4.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|