C23H31FN4O2 — CID 93296860
1-[(2S)-4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]heptan-1-one (PubChem CID 93296860) has the molecular formula C23H31FN4O2 and a molecular weight of 414.53 g/mol. Its IUPAC name is 1-[(2S)-4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]heptan-1-one.
| Compound Name | 1-[(2S)-4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 93296860 |
| Molecular Formula | C23H31FN4O2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 1-[(2S)-4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCN(c2cc(Oc3ccc(F)cc3C)ncn2)C[C@@H]1C |
| InChI | InChI=1S/C23H31FN4O2/c1-4-5-6-7-8-23(29)28-12-11-27(15-18(28)3)21-14-22(26-16-25-21)30-20-10-9-19(24)13-17(20)2/h9-10,13-14,16,18H,4-8,11-12,15H2,1-3H3/t18-/m0/s1 |
| InChIKey | XQWLXQZUCKXHTJ-SFHVURJKSA-N |
| XLogP | 4.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|