C22H29ClN4O2 — CID 93296777
1-[(2R)-4-[6-(2-chloro-5-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]hexan-1-one (PubChem CID 93296777) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 1-[(2R)-4-[6-(2-chloro-5-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]hexan-1-one.
| Compound Name | 1-[(2R)-4-[6-(2-chloro-5-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 93296777 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-[(2R)-4-[6-(2-chloro-5-methylphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCN(c2cc(Oc3cc(C)ccc3Cl)ncn2)C[C@H]1C |
| InChI | InChI=1S/C22H29ClN4O2/c1-4-5-6-7-22(28)27-11-10-26(14-17(27)3)20-13-21(25-15-24-20)29-19-12-16(2)8-9-18(19)23/h8-9,12-13,15,17H,4-7,10-11,14H2,1-3H3/t17-/m1/s1 |
| InChIKey | IKUOTLONBAYAIS-QGZVFWFLSA-N |
| XLogP | 4.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|