C25H29N3O4 — CID 83276312
3-[(2,5-dimethylphenyl)methyl]-8-[2-(3-methoxyphenyl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 83276312) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)methyl]-8-[2-(3-methoxyphenyl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(2,5-dimethylphenyl)methyl]-8-[2-(3-methoxyphenyl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 83276312 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)methyl]-8-[2-(3-methoxyphenyl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1cccc(CC(=O)N2CCC3(CC2)NC(=O)N(Cc2cc(C)ccc2C)C3=O)c1 |
| InChI | InChI=1S/C25H29N3O4/c1-17-7-8-18(2)20(13-17)16-28-23(30)25(26-24(28)31)9-11-27(12-10-25)22(29)15-19-5-4-6-21(14-19)32-3/h4-8,13-14H,9-12,15-16H2,1-3H3,(H,26,31) |
| InChIKey | SZYVTAFFIGAHMH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|