C23H24ClN3O4 — CID 83277160
3-[(2-chlorophenyl)methyl]-8-[2-(3-methylphenoxy)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 83277160) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-8-[2-(3-methylphenoxy)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(2-chlorophenyl)methyl]-8-[2-(3-methylphenoxy)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 83277160 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-8-[2-(3-methylphenoxy)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cccc(OCC(=O)N2CCC3(CC2)NC(=O)N(Cc2ccccc2Cl)C3=O)c1 |
| InChI | InChI=1S/C23H24ClN3O4/c1-16-5-4-7-18(13-16)31-15-20(28)26-11-9-23(10-12-26)21(29)27(22(30)25-23)14-17-6-2-3-8-19(17)24/h2-8,13H,9-12,14-15H2,1H3,(H,25,30) |
| InChIKey | QACCRNMVIJVVPF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|