C23H19ClN4O5 — CID 83277253
N-[2-[3-(3-chloro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]-N-(furan-2-ylmethyl)-3-nitrobenzamide (PubChem CID 83277253) has the molecular formula C23H19ClN4O5 and a molecular weight of 466.88 g/mol. Its IUPAC name is N-[2-[3-(3-chloro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]-N-(furan-2-ylmethyl)-3-nitrobenzamide.
| Compound Name | N-[2-[3-(3-chloro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]-N-(furan-2-ylmethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 83277253 |
| Molecular Formula | C23H19ClN4O5 |
| Molecular Weight | 466.88 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-[2-[3-(3-chloro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]-N-(furan-2-ylmethyl)-3-nitrobenzamide |
| SMILES | Cc1ccc(-c2noc(CCN(Cc3ccco3)C(=O)c3cccc([N+](=O)[O-])c3)n2)cc1Cl |
| InChI | InChI=1S/C23H19ClN4O5/c1-15-7-8-16(13-20(15)24)22-25-21(33-26-22)9-10-27(14-19-6-3-11-32-19)23(29)17-4-2-5-18(12-17)28(30)31/h2-8,11-13H,9-10,14H2,1H3 |
| InChIKey | OIXZJSBDHUDJEA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 115.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.88 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|