C24H28N6O2 — CID 83278309
N-[(4-morpholin-4-ylphenyl)methyl]-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-4-carboxamide (PubChem CID 83278309) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N-[(4-morpholin-4-ylphenyl)methyl]-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-4-carboxamide.
| Compound Name | N-[(4-morpholin-4-ylphenyl)methyl]-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 83278309 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | N-[(4-morpholin-4-ylphenyl)methyl]-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCOCC2)cc1)C1CCN(c2cnc3nccnc3c2)CC1 |
| InChI | InChI=1S/C24H28N6O2/c31-24(28-16-18-1-3-20(4-2-18)30-11-13-32-14-12-30)19-5-9-29(10-6-19)21-15-22-23(27-17-21)26-8-7-25-22/h1-4,7-8,15,17,19H,5-6,9-14,16H2,(H,28,31) |
| InChIKey | FIUNTUSFWDWLDR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|