C25H30N6O2 — CID 53166089
1-(2,3-dimethylpyrido[2,3-b]pyrazin-7-yl)-N-(4-morpholin-4-ylphenyl)piperidine-4-carboxamide (PubChem CID 53166089) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 1-(2,3-dimethylpyrido[2,3-b]pyrazin-7-yl)-N-(4-morpholin-4-ylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,3-dimethylpyrido[2,3-b]pyrazin-7-yl)-N-(4-morpholin-4-ylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53166089 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-(2,3-dimethylpyrido[2,3-b]pyrazin-7-yl)-N-(4-morpholin-4-ylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1nc2cc(N3CCC(C(=O)Nc4ccc(N5CCOCC5)cc4)CC3)cnc2nc1C |
| InChI | InChI=1S/C25H30N6O2/c1-17-18(2)28-24-23(27-17)15-22(16-26-24)30-9-7-19(8-10-30)25(32)29-20-3-5-21(6-4-20)31-11-13-33-14-12-31/h3-6,15-16,19H,7-14H2,1-2H3,(H,29,32) |
| InChIKey | FMGSBNUWYAIPCI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|