C17H17BrN2OS — CID 83281975
N-benzyl-3-bromo-4-propylthieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 83281975) has the molecular formula C17H17BrN2OS and a molecular weight of 377.31 g/mol. Its IUPAC name is N-benzyl-3-bromo-4-propylthieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | N-benzyl-3-bromo-4-propylthieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 83281975 |
| Molecular Formula | C17H17BrN2OS |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | N-benzyl-3-bromo-4-propylthieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | CCCn1c(C(=O)NCc2ccccc2)cc2scc(Br)c21 |
| InChI | InChI=1S/C17H17BrN2OS/c1-2-8-20-14(9-15-16(20)13(18)11-22-15)17(21)19-10-12-6-4-3-5-7-12/h3-7,9,11H,2,8,10H2,1H3,(H,19,21) |
| InChIKey | LFSQBWAWKQLQPT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |