C24H21F3N4O2S2 — CID 83283967
N-(2-methoxyethyl)-2-[[5-thiophen-2-yl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide (PubChem CID 83283967) has the molecular formula C24H21F3N4O2S2 and a molecular weight of 518.59 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[5-thiophen-2-yl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide.
| Compound Name | N-(2-methoxyethyl)-2-[[5-thiophen-2-yl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 83283967 |
| Molecular Formula | C24H21F3N4O2S2 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[5-thiophen-2-yl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide |
| SMILES | COCCNC(=O)c1ccccc1CSc1nnc(-c2cccs2)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21F3N4O2S2/c1-33-12-11-28-22(32)19-9-3-2-6-16(19)15-35-23-30-29-21(20-10-5-13-34-20)31(23)18-8-4-7-17(14-18)24(25,26)27/h2-10,13-14H,11-12,15H2,1H3,(H,28,32) |
| InChIKey | DCHKWMXNGDRPFU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|