C25H25N5O3S — CID 83285372
N-(2-methoxyethyl)-2-[[4-(2-methoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide (PubChem CID 83285372) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[4-(2-methoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide.
| Compound Name | N-(2-methoxyethyl)-2-[[4-(2-methoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 83285372 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[4-(2-methoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide |
| SMILES | COCCNC(=O)c1ccccc1CSc1nnc(-c2cccnc2)n1-c1ccccc1OC |
| InChI | InChI=1S/C25H25N5O3S/c1-32-15-14-27-24(31)20-10-4-3-8-19(20)17-34-25-29-28-23(18-9-7-13-26-16-18)30(25)21-11-5-6-12-22(21)33-2/h3-13,16H,14-15,17H2,1-2H3,(H,27,31) |
| InChIKey | VKVBRQODKOLESE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|