C21H27ClN4O — CID 83286971
4-(2-chloro-5-methylphenoxy)-6-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine (PubChem CID 83286971) has the molecular formula C21H27ClN4O and a molecular weight of 386.93 g/mol. Its IUPAC name is 4-(2-chloro-5-methylphenoxy)-6-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine.
| Compound Name | 4-(2-chloro-5-methylphenoxy)-6-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 83286971 |
| Molecular Formula | C21H27ClN4O |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-(2-chloro-5-methylphenoxy)-6-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine |
| SMILES | Cc1ccc(Cl)c(Oc2cc(N3CCC(N4CCCCC4)CC3)ncn2)c1 |
| InChI | InChI=1S/C21H27ClN4O/c1-16-5-6-18(22)19(13-16)27-21-14-20(23-15-24-21)26-11-7-17(8-12-26)25-9-3-2-4-10-25/h5-6,13-15,17H,2-4,7-12H2,1H3 |
| InChIKey | ODMBGKCPONKXSI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |