About 9,10-dioxoanthracene-1,5-disulfonic acid
9,10-dioxoanthracene-1,5-disulfonic acid (PubChem CID 8329) has the molecular formula C14H8O8S2
and a molecular weight of 368.34 g/mol. Its IUPAC name is 9,10-dioxoanthracene-1,5-disulfonic acid.
Molecular Properties
| Compound Name | 9,10-dioxoanthracene-1,5-disulfonic acid |
| PubChem CID | 8329 |
| Molecular Formula | C14H8O8S2 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 9,10-dioxoanthracene-1,5-disulfonic acid |
| SMILES | O=C1c2cccc(S(=O)(=O)O)c2C(=O)c2cccc(S(=O)(=O)O)c21 |
| InChI | InChI=1S/C14H8O8S2/c15-13-7-3-1-5-9(23(17,18)19)11(7)14(16)8-4-2-6-10(12(8)13)24(20,21)22/h1-6H,(H,17,18,19)(H,20,21,22) |
| InChIKey | OZTBHAGJSKTDGM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 9,10-dioxoanthracene-1,5-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dioxoanthracene-1,5-disulfonic acid?
The IUPAC name of 9,10-dioxoanthracene-1,5-disulfonic acid (CID 8329) is 9,10-dioxoanthracene-1,5-disulfonic acid.
What is the SMILES notation for 9,10-dioxoanthracene-1,5-disulfonic acid?
The canonical SMILES for 9,10-dioxoanthracene-1,5-disulfonic acid is O=C1c2cccc(S(=O)(=O)O)c2C(=O)c2cccc(S(=O)(=O)O)c21.
What is the InChIKey of 9,10-dioxoanthracene-1,5-disulfonic acid?
The InChIKey is OZTBHAGJSKTDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O8S2/c15-13-7-3-1-5-9(23(17,18)19)11(7)14(16)8-4-2-6-10(12(8)13)24(20,21)22/h1-6H,(H,17,18,19)(H,20,21,22).
What are the key properties of 9,10-dioxoanthracene-1,5-disulfonic acid?
9,10-dioxoanthracene-1,5-disulfonic acid has a molecular weight of 368.34 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dioxoanthracene-1,5-disulfonic acid is sourced from PubChem (CID 8329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).