About Diphenylacetic Acid
Diphenylacetic Acid (PubChem CID 8333) has the molecular formula C14H12O2
and a molecular weight of 212.24 g/mol. Its IUPAC name is 2,2-diphenylacetic acid.
Molecular Properties
| Compound Name | Diphenylacetic Acid |
| PubChem CID | 8333 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2,2-diphenylacetic acid |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)O |
| InChI | InChI=1S/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| InChIKey | PYHXGXCGESYPCW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 207 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Diphenylacetic Acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diphenylacetic Acid?
The IUPAC name of Diphenylacetic Acid (CID 8333) is 2,2-diphenylacetic acid.
What is the SMILES notation for Diphenylacetic Acid?
The canonical SMILES for Diphenylacetic Acid is C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)O.
What is the InChIKey of Diphenylacetic Acid?
The InChIKey is PYHXGXCGESYPCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16).
What are the key properties of Diphenylacetic Acid?
Diphenylacetic Acid has a molecular weight of 212.24 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Diphenylacetic Acid is sourced from PubChem (CID 8333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).