About 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine
3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 83380818) has the molecular formula C7H13N3S2
and a molecular weight of 203.34 g/mol. Its IUPAC name is 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine.
Analyze 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine (CID 83380818) is 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine is CCSc1nsc(NC(C)C)n1.
What is the InChIKey of 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine?
The InChIKey is VASWDFTYOOUADC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3S2/c1-4-11-7-9-6(12-10-7)8-5(2)3/h5H,4H2,1-3H3,(H,8,9,10).
What are the key properties of 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine?
3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine has a molecular weight of 203.34 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfanyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 83380818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).