C13H13N3O — CID 83408824
N-(3,5-dimethylphenyl)pyrimidine-5-carboxamide (PubChem CID 83408824) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)pyrimidine-5-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 83408824 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(3,5-dimethylphenyl)pyrimidine-5-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cncnc2)c1 |
| InChI | InChI=1S/C13H13N3O/c1-9-3-10(2)5-12(4-9)16-13(17)11-6-14-8-15-7-11/h3-8H,1-2H3,(H,16,17) |
| InChIKey | AQFVVGUGROMTFC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |