C16H13ClN4O2 — CID 834469
2-chloro-N-(2-hydroxy-4-methylphenyl)-5-(1,2,4-triazol-4-yl)benzamide (PubChem CID 834469) has the molecular formula C16H13ClN4O2 and a molecular weight of 328.76 g/mol. Its IUPAC name is 2-chloro-N-(2-hydroxy-4-methylphenyl)-5-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 2-chloro-N-(2-hydroxy-4-methylphenyl)-5-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 834469 |
| Molecular Formula | C16H13ClN4O2 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-chloro-N-(2-hydroxy-4-methylphenyl)-5-(1,2,4-triazol-4-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(-n3cnnc3)ccc2Cl)c(O)c1 |
| InChI | InChI=1S/C16H13ClN4O2/c1-10-2-5-14(15(22)6-10)20-16(23)12-7-11(3-4-13(12)17)21-8-18-19-9-21/h2-9,22H,1H3,(H,20,23) |
| InChIKey | HFYNWQWJECVJCY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|