C17H15ClN4O3 — CID 39890234
2-[4-chloro-2-(1,2,4-triazol-4-yl)phenoxy]-N-(2-hydroxy-4-methylphenyl)acetamide (PubChem CID 39890234) has the molecular formula C17H15ClN4O3 and a molecular weight of 358.79 g/mol. Its IUPAC name is 2-[4-chloro-2-(1,2,4-triazol-4-yl)phenoxy]-N-(2-hydroxy-4-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-(1,2,4-triazol-4-yl)phenoxy]-N-(2-hydroxy-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 39890234 |
| Molecular Formula | C17H15ClN4O3 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[4-chloro-2-(1,2,4-triazol-4-yl)phenoxy]-N-(2-hydroxy-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(Cl)cc2-n2cnnc2)c(O)c1 |
| InChI | InChI=1S/C17H15ClN4O3/c1-11-2-4-13(15(23)6-11)21-17(24)8-25-16-5-3-12(18)7-14(16)22-9-19-20-10-22/h2-7,9-10,23H,8H2,1H3,(H,21,24) |
| InChIKey | XCFKUESWDVXZPH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|