C20H22N4O3 — CID 39890185
N-(2-hydroxy-5-propan-2-ylphenyl)-2-[4-methyl-2-(1,2,4-triazol-4-yl)phenoxy]acetamide (PubChem CID 39890185) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-(2-hydroxy-5-propan-2-ylphenyl)-2-[4-methyl-2-(1,2,4-triazol-4-yl)phenoxy]acetamide.
| Compound Name | N-(2-hydroxy-5-propan-2-ylphenyl)-2-[4-methyl-2-(1,2,4-triazol-4-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 39890185 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-(2-hydroxy-5-propan-2-ylphenyl)-2-[4-methyl-2-(1,2,4-triazol-4-yl)phenoxy]acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2cc(C(C)C)ccc2O)c(-n2cnnc2)c1 |
| InChI | InChI=1S/C20H22N4O3/c1-13(2)15-5-6-18(25)16(9-15)23-20(26)10-27-19-7-4-14(3)8-17(19)24-11-21-22-12-24/h4-9,11-13,25H,10H2,1-3H3,(H,23,26) |
| InChIKey | NYRWYMGHYJKRRN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|