C17H15ClN4O2 — CID 39890141
N-(4-chlorophenyl)-2-[4-methyl-2-(1,2,4-triazol-4-yl)phenoxy]acetamide (PubChem CID 39890141) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-methyl-2-(1,2,4-triazol-4-yl)phenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-methyl-2-(1,2,4-triazol-4-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 39890141 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-methyl-2-(1,2,4-triazol-4-yl)phenoxy]acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc(Cl)cc2)c(-n2cnnc2)c1 |
| InChI | InChI=1S/C17H15ClN4O2/c1-12-2-7-16(15(8-12)22-10-19-20-11-22)24-9-17(23)21-14-5-3-13(18)4-6-14/h2-8,10-11H,9H2,1H3,(H,21,23) |
| InChIKey | VFZWSHCLIAZECF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |