C7H7BrFN — CID 83485488
2-bromo-5-fluoro-3,4-dimethylpyridine (PubChem CID 83485488) has the molecular formula C7H7BrFN and a molecular weight of 204.04 g/mol. Its IUPAC name is 2-bromo-5-fluoro-3,4-dimethylpyridine.
| Compound Name | 2-bromo-5-fluoro-3,4-dimethylpyridine |
|---|---|
| PubChem CID | 83485488 |
| Molecular Formula | C7H7BrFN |
| Molecular Weight | 204.04 g/mol |
| Exact Mass | 202.97 |
| IUPAC Name | 2-bromo-5-fluoro-3,4-dimethylpyridine |
| SMILES | Cc1c(F)cnc(Br)c1C |
| InChI | InChI=1S/C7H7BrFN/c1-4-5(2)7(8)10-3-6(4)9/h3H,1-2H3 |
| InChIKey | FSGZDDOMQKZXHP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.04 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|