C20H28N2S — CID 83526081
4-[[4-(4-butylcyclohexyl)-1,3-thiazol-2-yl]methyl]aniline (PubChem CID 83526081) has the molecular formula C20H28N2S and a molecular weight of 328.52 g/mol. Its IUPAC name is 4-[[4-(4-butylcyclohexyl)-1,3-thiazol-2-yl]methyl]aniline.
| Compound Name | 4-[[4-(4-butylcyclohexyl)-1,3-thiazol-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 83526081 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 4-[[4-(4-butylcyclohexyl)-1,3-thiazol-2-yl]methyl]aniline |
| SMILES | CCCCC1CCC(c2csc(Cc3ccc(N)cc3)n2)CC1 |
| InChI | InChI=1S/C20H28N2S/c1-2-3-4-15-5-9-17(10-6-15)19-14-23-20(22-19)13-16-7-11-18(21)12-8-16/h7-8,11-12,14-15,17H,2-6,9-10,13,21H2,1H3 |
| InChIKey | LOBJCYIXPBHWFH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|