5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid

C7H10N2O3 — CID 83529452

IUPAC5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid
SMILESCC(C)c1c(C(=O)O)noc1N
InChIInChI=1S/C7H10N2O3/c1-3(2)4-5(7(10)11)9-12-6(4)8/h3H,8H2,1-2H3,(H,10,11)
InChIKeyASJOOPSQCCBIBF-UHFFFAOYSA-N
MW170.17 g/mol
LogP1.08
Rot. Bonds2

About 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid

5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid (PubChem CID 83529452) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid
PubChem CID83529452
Molecular FormulaC7H10N2O3
Molecular Weight170.17 g/mol
Exact Mass170.07
IUPAC Name5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid
SMILESCC(C)c1c(C(=O)O)noc1N
InChIInChI=1S/C7H10N2O3/c1-3(2)4-5(7(10)11)9-12-6(4)8/h3H,8H2,1-2H3,(H,10,11)
InChIKeyASJOOPSQCCBIBF-UHFFFAOYSA-N
XLogP1.08
TPSA89.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.17
LogP ≤ 51.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid (CID 83529452) is 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid is CC(C)c1c(C(=O)O)noc1N.
What is the InChIKey of 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid?
The InChIKey is ASJOOPSQCCBIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-3(2)4-5(7(10)11)9-12-6(4)8/h3H,8H2,1-2H3,(H,10,11).
What are the key properties of 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid?
5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid has a molecular weight of 170.17 g/mol, XLogP of 1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-propan-2-yl-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 83529452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).