C10H15N3O — CID 83531039
N'-amino-2-methoxy-3,5-dimethylbenzenecarboximidamide (PubChem CID 83531039) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is N'-amino-2-methoxy-3,5-dimethylbenzenecarboximidamide.
| Compound Name | N'-amino-2-methoxy-3,5-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 83531039 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N'-amino-2-methoxy-3,5-dimethylbenzenecarboximidamide |
| SMILES | COc1c(C)cc(C)cc1/C(N)=N/N |
| InChI | InChI=1S/C10H15N3O/c1-6-4-7(2)9(14-3)8(5-6)10(11)13-12/h4-5H,12H2,1-3H3,(H2,11,13) |
| InChIKey | VDMOHGQRFIJFPB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|